Difference between revisions of "CPD-8619"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MTHFCx MTHFCx] == * direction: ** LEFT-TO-RIGHT * common name: ** Methenyltetrahydrofolate cyclohyd...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-]...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MTHFCx MTHFCx] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
 
* common name:
 
* common name:
−
** Methenyltetrahydrofolate cyclohydrolase
+
** 4α-carboxy-5α-cholesta-8-en-3β-ol
 +
* inchi key:
 +
** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
 +
* molecular weight:
 +
** 429.662   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-23]]
−
** 1.0 [[10-FORMYL-THF]][x] '''+''' 1.0 [[PROTON]][x] '''=>''' 1.0 [[WATER]][x] '''+''' 1.0 [[5-10-METHENYL-THF]][x]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 10-formyl-tetrahydrofolate mono-L-glutamate[x] '''+''' 1.0 H+[x] '''=>''' 1.0 H2O[x] '''+''' 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[x]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_432]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Methenyltetrahydrofolate cyclohydrolase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826593 91826593]
−
{{#set: gene associated=Tiso_gene_432}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87055 87055]
−
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB12166
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=4α-carboxy-5α-cholesta-8-en-3β-ol}}
 +
{{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}}
 +
{{#set: molecular weight=429.662    }}
 +
{{#set: consumed by=RXN66-23}}

Latest revision as of 19:33, 21 March 2018

Metabolite CPD-8619

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
  • common name:
    • 4α-carboxy-5α-cholesta-8-en-3β-ol
  • inchi key:
    • InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
  • molecular weight:
    • 429.662
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-8619&oldid=42309"