Difference between revisions of "PWY-7279"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETATE_AUXIN INDOLE_ACETATE_AUXIN] == * smiles: ** C([O-])(=O)CC1(=CNC2(C=CC=CC1=2)) *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7279 PWY-7279] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7279 PWY-7279] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** aerobic respiration II (cytochrome c) (yeast) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''4''' reactions found over '''4''' reactions in the full pathway | |
| − | * [[ | + | * [[1.10.2.2-RXN]] |
| − | * [[ | + | ** 5 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_15926]] |
| − | * [[RXN- | + | *** [[Tiso_gene_9627]] |
| − | * [[RXN- | + | *** [[Tiso_gene_18330]] |
| − | == Reaction(s) | + | *** [[Tiso_gene_7235]] |
| + | *** [[Tiso_gene_4973]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[CYTOCHROME-C-OXIDASE-RXN]] | ||
| + | ** 4 associated gene(s): | ||
| + | *** [[Tiso_gene_18580]] | ||
| + | *** [[Tiso_gene_15682]] | ||
| + | *** [[Tiso_gene_7948]] | ||
| + | *** [[Tiso_gene_18053]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN0-5330]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_18172]] | ||
| + | *** [[Tiso_gene_18831]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[manual-primary_network]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=aerobic respiration II (cytochrome c) (yeast)}} | |
| − | + | {{#set: reaction found=4}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:33, 21 March 2018
Pathway PWY-7279
- taxonomic range:
- common name:
- aerobic respiration II (cytochrome c) (yeast)
- Synonym(s):
Reaction(s) found
4 reactions found over 4 reactions in the full pathway
- 1.10.2.2-RXN
- 5 associated gene(s):
- 4 reconstruction source(s) associated:
- CYTOCHROME-C-OXIDASE-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
- RXN0-5330
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
