Difference between revisions of "Tiso gene 915"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * inchi ke...") |
(Created page with "Category:Gene == Gene Tiso_gene_915 == * right end position: ** 1525 * transcription direction: ** POSITIVE * left end position: ** 455 * centisome position: ** 1.6541245...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_915 == |
− | * | + | * right end position: |
− | ** | + | ** 1525 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 455 |
− | * | + | * centisome position: |
− | ** | + | ** 1.6541245 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-8042]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
+ | * [[PWY-6475]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1525}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=455}} | |
− | + | {{#set: centisome position=1.6541245 }} | |
− | + | {{#set: reaction associated=RXN-8042}} | |
− | + | {{#set: pathway associated=PWY-6475}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:33, 21 March 2018
Gene Tiso_gene_915
- right end position:
- 1525
- transcription direction:
- POSITIVE
- left end position:
- 455
- centisome position:
- 1.6541245
- Synonym(s):
Reactions associated
- Reaction: RXN-8042
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation