Difference between revisions of "CPD-14706"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5707 PWY-5707] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40553 TAX-4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] == * smiles: ** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-] * common name: ** 4-hyd...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-] |
* common name: | * common name: | ||
| − | ** | + | ** 4-hydroxy-2-nonenal-[L-Cys] conjugate |
| + | * inchi key: | ||
| + | ** InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N | ||
| + | * molecular weight: | ||
| + | ** 277.378 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-13677]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | * [ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657989 90657989] |
| − | {{#set: common name= | + | {{#set: smiles=CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]}} |
| − | {{#set: | + | {{#set: common name=4-hydroxy-2-nonenal-[L-Cys] conjugate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=277.378 }} |
| + | {{#set: produced by=RXN-13677}} | ||
Latest revision as of 19:33, 21 March 2018
Contents
Metabolite CPD-14706
- smiles:
- CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]
- common name:
- 4-hydroxy-2-nonenal-[L-Cys] conjugate
- inchi key:
- InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N
- molecular weight:
- 277.378
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.
"4-hydroxy-2-nonenal-[L-Cys] conjugate" cannot be used as a page name in this wiki.
