Difference between revisions of "PWY-102"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THF THF] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-102 PWY-102] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3195 TAX-3195...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THF THF] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-102 PWY-102] ==
−
* smiles:
+
* taxonomic range:
−
** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N3))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3195 TAX-3195]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58023 TAX-58023]
−
** InChIKey=MSTNYGQPCMXVAQ-RYUDHWBXSA-L
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* common name:
 
* common name:
−
** tetrahydropteroyl mono-L-glutamate
+
** gibberellin inactivation I (2β-hydroxylation)
−
* molecular weight:
+
−
** 443.418   
+
 
* Synonym(s):
 
* Synonym(s):
−
** H4PteGlu
+
** gibberellin 2β-hydroxylation
−
** 5,6,7,8-tetrahydrofolic acid
+
−
** tetrahydrofolic acid
+
−
** (6S)-tetrahydrofolate
+
−
** H4PteGlu1
+
−
** tetrahydrofolate
+
−
** tetrahydrafolate
+
−
** 5,6,7,8-tetrahydrofolate
+
−
** THF
+
−
** tetra-H-folate
+
−
** th-folate
+
−
** FH4
+
−
** folate-H4
+
−
** tetrahydropteroylglutamate
+
−
** H4F
+
−
** vitamin B9
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[FTHFL]]
+
'''4''' reactions found over '''11''' reactions in the full pathway
−
* [[FGFTm]]
+
* [[RXN-113]]
−
== Reaction(s) known to produce the compound ==
+
** 1 associated gene(s):
−
* [[MTMOHT]]
+
*** [[Tiso_gene_3330]]
−
* [[R00946]]
+
** 2 reconstruction source(s) associated:
−
* [[FTHFO]]
+
*** [[orthology-athaliana]]
−
* [[R00939]]
+
*** [[orthology-esiliculosus]]
−
* [[R01226]]
+
* [[RXN-115]]
−
* [[R04560]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_3330]]
−
* [[FPGFTm]]
+
** 2 reconstruction source(s) associated:
−
* [[THFtm]]
+
*** [[orthology-athaliana]]
−
* [[FPAIF]]
+
*** [[orthology-esiliculosus]]
 +
* [[RXN-171]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3330]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-6550]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3330]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-114 RXN-114]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-118 RXN-118]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-172 RXN-172]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-292 RXN-292]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-886 RXN-886]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-947 RXN-947]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-991 RXN-991]
 
== External links  ==
 
== External links  ==
−
* CAS : 135-16-0
+
* ARACYC:
−
* CAS : 29347-89-5
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-102 PWY-102]
−
* METABOLIGHTS : MTBLC57453
+
{{#set: taxonomic range=TAX-3195}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-58023}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25790919 25790919]
+
{{#set: taxonomic range=TAX-2}}
−
* HMDB : HMDB01846
+
{{#set: taxonomic range=TAX-4751}}
−
* LIGAND-CPD:
+
{{#set: common name=gibberellin inactivation I (2β-hydroxylation)}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00101 C00101]
+
{{#set: common name=gibberellin 2β-hydroxylation}}
−
* CHEBI:
+
{{#set: reaction found=4}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57453 57453]
+
{{#set: total reaction=11}}
−
* BIGG : thf
+
{{#set: completion rate=36.0}}
−
{{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N3))}}
+
−
{{#set: inchi key=InChIKey=MSTNYGQPCMXVAQ-RYUDHWBXSA-L}}
+
−
{{#set: common name=tetrahydropteroyl mono-L-glutamate}}
+
−
{{#set: molecular weight=443.418    }}
+
−
{{#set: common name=H4PteGlu|5,6,7,8-tetrahydrofolic acid|tetrahydrofolic acid|(6S)-tetrahydrofolate|H4PteGlu1|tetrahydrofolate|tetrahydrafolate|5,6,7,8-tetrahydrofolate|THF|tetra-H-folate|th-folate|FH4|folate-H4|tetrahydropteroylglutamate|H4F|vitamin B9}}
+
−
{{#set: consumed by=FTHFL|FGFTm}}
+
−
{{#set: produced by=MTMOHT|R00946|FTHFO|R00939|R01226|R04560}}
+
−
{{#set: reversible reaction associated=FPGFTm|THFtm|FPAIF}}
+

Latest revision as of 19:33, 21 March 2018

Pathway PWY-102

  • taxonomic range:
  • common name:
    • gibberellin inactivation I (2β-hydroxylation)
  • Synonym(s):
    • gibberellin 2β-hydroxylation

Reaction(s) found

4 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-102&oldid=42337"