Difference between revisions of "TROPINONE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6185 PWY-6185] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] == * smiles: ** C[N+]1(C2(CCC1CC(=O)C2)) * common name: ** tropinone * inc...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6185 PWY-6185] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** C[N+]1(C2(CCC1CC(=O)C2))
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
** 4-methylcatechol degradation (ortho cleavage)
+
** tropinone
 +
* inchi key:
 +
** InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O
 +
* molecular weight:
 +
** 140.205   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''7''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[RXN-10083]]
+
== Reaction(s) of unknown directionality ==
** 1 associated gene(s):
+
* [[TROPINE-DEHYDROGENASE-RXN]]
*** [[Tiso_gene_10066]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=5.4.99.14-RXN 5.4.99.14-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10080 RXN-10080]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10081 RXN-10081]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10082 RXN-10082]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10085 RXN-10085]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10086 RXN-10086]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-4751}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=698003 698003]
{{#set: common name=4-methylcatechol degradation (ortho cleavage)}}
+
* CAS : 532-24-1
{{#set: reaction found=1}}
+
* NCI:
{{#set: total reaction=7}}
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=118012 118012]
{{#set: completion rate=14.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00783 C00783]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.2789160.html 2789160]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57851 57851]
 +
{{#set: smiles=C[N+]1(C2(CCC1CC(=O)C2))}}
 +
{{#set: common name=tropinone}}
 +
{{#set: inchi key=InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O}}
 +
{{#set: molecular weight=140.205    }}
 +
{{#set: reversible reaction associated=TROPINE-DEHYDROGENASE-RXN}}

Latest revision as of 20:33, 21 March 2018

Metabolite TROPINONE

  • smiles:
    • C[N+]1(C2(CCC1CC(=O)C2))
  • common name:
    • tropinone
  • inchi key:
    • InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O
  • molecular weight:
    • 140.205
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C[N+]1(C2(CCC1CC(=O)C2))" cannot be used as a page name in this wiki.