Difference between revisions of "RXN66-350"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PTEROATE PTEROATE] == * smiles: ** C(NC1(C=CC(C(=O)[O-])=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-350 RXN66-350] == * direction: ** REVERSIBLE * common name: ** 3-beta_hydroxysteroid_dehydrog...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PTEROATE PTEROATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-350 RXN66-350] ==
−
* smiles:
+
* direction:
−
** C(NC1(C=CC(C(=O)[O-])=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=JOAQINSXLLMRCV-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** pteroate
+
** 3-beta_hydroxysteroid_dehydrogenase_isomerase
−
* molecular weight:
+
** ORF
−
** 311.279   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.145 EC-1.1.1.145]
 
* Synonym(s):
 
* Synonym(s):
−
** 4-{[(2-amino-4-hydroxypteridin-6-yl)methyl]amino}benzoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[3.4.17.11-RXN]]
+
** 1 [[NAD]][c] '''+''' 1 [[CPD66-23]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[CPD66-27]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NAD+[c] '''+''' 1 17-&alpha;-hydroxypregnenolone[c] '''<=>''' 1 NADH[c] '''+''' 1 pregn-5-ene-3,20-dione-17-ol[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_897]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_2957]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_11016]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18774]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 119-24-4
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: common name=3-beta_hydroxysteroid_dehydrogenase_isomerase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6951470 6951470]
+
{{#set: common name=ORF}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-1.1.1.145}}
−
** [http://www.chemspider.com/Chemical-Structure.5324366.html 5324366]
+
{{#set: gene associated=Tiso_gene_897|Tiso_gene_2957|Tiso_gene_11016|Tiso_gene_18774}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38793 38793]
+
{{#set: reconstruction category=annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C07582 C07582]
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C(NC1(C=CC(C(=O)[O-])=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))}}
+
−
{{#set: inchi key=InChIKey=JOAQINSXLLMRCV-UHFFFAOYSA-M}}
+
−
{{#set: common name=pteroate}}
+
−
{{#set: molecular weight=311.279    }}
+
−
{{#set: common name=4-{[(2-amino-4-hydroxypteridin-6-yl)methyl]amino}benzoate}}
+
−
{{#set: produced by=3.4.17.11-RXN}}
+

Latest revision as of 19:34, 21 March 2018

Reaction RXN66-350

  • direction:
    • REVERSIBLE
  • common name:
    • 3-beta_hydroxysteroid_dehydrogenase_isomerase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 17-α-hydroxypregnenolone[c] <=> 1 NADH[c] + 1 pregn-5-ene-3,20-dione-17-ol[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN66-350&oldid=42420"