Difference between revisions of "PROTEIN-ARGININE-DEIMINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-ARGININE-DEIMINASE-RXN PROTEIN-ARGININE-DEIMINASE-RXN] == * direction: ** LEFT-TO-RIGHT * c...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-ARGININE-DEIMINASE-RXN PROTEIN-ARGININE-DEIMINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** peptidylarginine_deiminase_(modular_protein) |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.5.3.15 EC-3.5.3.15] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[Protein-L-Arginines]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTEIN-L-CITRULLINE]][c] '''+''' 1 [[AMMONIUM]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a [protein]-L-arginine[c] '''+''' 1 H2O[c] '''=>''' 1 a [protein]-L-citrulline[c] '''+''' 1 ammonium[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_16344]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_19262]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-4921]], protein citrullination: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4921 PWY-4921] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02621 R02621] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q08642 Q08642] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P20717 P20717] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P70708 P70708] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=peptidylarginine_deiminase_(modular_protein)}} |
+ | {{#set: ec number=EC-3.5.3.15}} | ||
+ | {{#set: gene associated=Tiso_gene_16344|Tiso_gene_19262}} | ||
+ | {{#set: in pathway=PWY-4921}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:26, 21 March 2018
Contents
Reaction PROTEIN-ARGININE-DEIMINASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- peptidylarginine_deiminase_(modular_protein)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Protein-L-Arginines[c] + 1 WATER[c] => 1 PROTEIN-L-CITRULLINE[c] + 1 AMMONIUM[c]
- With common name(s):
- 1 a [protein]-L-arginine[c] + 1 H2O[c] => 1 a [protein]-L-citrulline[c] + 1 ammonium[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16344
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_19262
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links