Difference between revisions of "RXN0-5515"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] == * smiles: ** C(C1(=CC=CC=C1O))([O-])=O * inchi key: ** InChIKey=YGSDEFSMJLZ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5515 RXN0-5515] == * direction: ** LEFT-TO-RIGHT * common name: ** phosphatidate_cytidylyltran...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5515 RXN0-5515] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** phosphatidate_cytidylyltransferase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.7.7.41 EC-2.7.7.41] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[1 | + | ** 1 [[2-3-4-Saturated-L-Phosphatidates]][c] '''+''' 1 [[CTP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CDP-2-3-4-Saturated-Diacylglycerols]][c] '''+''' 1 [[PPI]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 a 1,2-diacyl-sn-glycerol 3-phosphate[c] '''+''' 1 CTP[c] '''+''' 1 H+[c] '''=>''' 1 a CDP-2,3,4-saturated-diacylglycerol[c] '''+''' 1 diphosphate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_2311]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | * Gene: [[Tiso_gene_3522]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_3523]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=phosphatidate_cytidylyltransferase}} | |
| − | + | {{#set: ec number=EC-2.7.7.41}} | |
| − | + | {{#set: gene associated=Tiso_gene_2311|Tiso_gene_3522|Tiso_gene_3523}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology|annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:34, 21 March 2018
Contents
Reaction RXN0-5515
- direction:
- LEFT-TO-RIGHT
- common name:
- phosphatidate_cytidylyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-3-4-Saturated-L-Phosphatidates[c] + 1 CTP[c] + 1 PROTON[c] => 1 CDP-2-3-4-Saturated-Diacylglycerols[c] + 1 PPI[c]
- With common name(s):
- 1 a 1,2-diacyl-sn-glycerol 3-phosphate[c] + 1 CTP[c] + 1 H+[c] => 1 a CDP-2,3,4-saturated-diacylglycerol[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2311
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_3522
- Source: orthology-esiliculosus
- Gene: Tiso_gene_3523
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
