Difference between revisions of "Tiso gene 2613"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] == * smiles: ** C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene Tiso_gene_2613 == * right end position: ** 18160 * transcription direction: ** NEGATIVE * left end position: ** 15857 * centisome position: ** 74.153...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2613 == |
− | * | + | * right end position: |
− | ** | + | ** 18160 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 15857 |
− | * | + | * centisome position: |
− | ** | + | ** 74.15357 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-10625]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[RXN- | + | *** Assignment: automated-name-match |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | + | *** Assignment: automated-name-match | |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
− | * [[ | + | ** Source: [[orthology-synechocystis]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
+ | * Reaction: [[RXN-17428]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[RXN-3142]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Reaction: [[RXN-7658]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-7659]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-7660]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-7664]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-7665]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-7666]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5064]] | ||
+ | * [[PWY-5063]] | ||
+ | * [[PWY1F-FLAVSYN]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=18160}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=15857}} | |
− | + | {{#set: centisome position=74.15357 }} | |
− | + | {{#set: reaction associated=RXN-10625|RXN-17428|RXN-3142|RXN-7658|RXN-7659|RXN-7660|RXN-7664|RXN-7665|RXN-7666}} | |
− | + | {{#set: pathway associated=PWY-5064|PWY-5063|PWY1F-FLAVSYN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 19:34, 21 March 2018
Gene Tiso_gene_2613
- right end position:
- 18160
- transcription direction:
- NEGATIVE
- left end position:
- 15857
- centisome position:
- 74.15357
- Synonym(s):
Reactions associated
- Reaction: RXN-10625
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: RXN-17428
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: RXN-3142
- Source: orthology-athaliana
- Reaction: RXN-7658
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-7659
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-7660
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-7664
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-7665
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-7666
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation