Difference between revisions of "Tiso gene 19347"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == * smiles: ** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(...")
(Created page with "Category:Gene == Gene Tiso_gene_19347 == * right end position: ** 1951 * transcription direction: ** POSITIVE * left end position: ** 173 * centisome position: ** 7.223382...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] ==
+
== Gene Tiso_gene_19347 ==
−
* smiles:
+
* right end position:
−
** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1951
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (2E)-5-methylhexa-2,4-dienoyl-CoA
+
** 173
−
* molecular weight:
+
* centisome position:
−
** 871.642    
+
** 7.223382    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11919]]
+
* Reaction: [[3.6.1.41-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=1951}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986176 50986176]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: left end position=173}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16468 C16468]
+
{{#set: centisome position=7.223382   }}
−
{{#set: smiles=CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=3.6.1.41-RXN}}
−
{{#set: inchi key=InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J}}
+
−
{{#set: common name=(2E)-5-methylhexa-2,4-dienoyl-CoA}}
+
−
{{#set: molecular weight=871.642   }}
+
−
{{#set: consumed by=RXN-11919}}
+

Latest revision as of 20:34, 21 March 2018

Gene Tiso_gene_19347

  • right end position:
    • 1951
  • transcription direction:
    • POSITIVE
  • left end position:
    • 173
  • centisome position:
    • 7.223382
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19347&oldid=42465"