Difference between revisions of "RXN-16649"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] == * smiles: ** CC(OCCC(C([O-])=O)[N+])=O * inchi key: ** InChIKey=FCXZBWSIAGG...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16649 RXN-16649] == * direction: ** LEFT-TO-RIGHT * common name: ** beta-lactamase * ec number:...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16649 RXN-16649] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** beta-lactamase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.4.16.4 EC-3.4.16.4] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1 [[CPD-17927]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-17926]][c] '''+''' 1 [[D-ALANINE]][c] |
| − | == | + | * With common name(s): |
| − | == | + | ** 1 a nascent peptidoglycan with (L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine) pentapeptide[c] '''+''' 1 H2O[c] '''=>''' 1 a nascent peptidoglycan with (L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanine) tetrapeptide[c] '''+''' 1 D-alanine[c] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_18870]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWY0-1586]], peptidoglycan maturation (meso-diaminopimelate containing): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1586 PWY0-1586] | ||
| + | ** '''2''' reactions found over '''12''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=beta-lactamase}} | |
| − | + | {{#set: ec number=EC-3.4.16.4}} | |
| − | + | {{#set: gene associated=Tiso_gene_18870}} | |
| − | + | {{#set: in pathway=PWY0-1586}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:34, 21 March 2018
Contents
Reaction RXN-16649
- direction:
- LEFT-TO-RIGHT
- common name:
- beta-lactamase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 a nascent peptidoglycan with (L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine) pentapeptide[c] + 1 H2O[c] => 1 a nascent peptidoglycan with (L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanine) tetrapeptide[c] + 1 D-alanine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18870
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY0-1586, peptidoglycan maturation (meso-diaminopimelate containing): PWY0-1586
- 2 reactions found over 12 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
