Difference between revisions of "CPD-13534"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LL-DIAMINOPIMELATE LL-DIAMINOPIMELATE] == * smiles: ** C(C(CCCC(C([O-])=O)[N+])[N+])([O-])=O *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] == * smiles: ** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OC...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] == |
* smiles: | * smiles: | ||
− | ** C(C( | + | ** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** β-ketovaleryl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 861.604 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[RXN-12560]] |
− | * [[ | + | * [[RXN-12561]] |
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658928 90658928] |
− | + | {{#set: smiles=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | + | {{#set: common name=β-ketovaleryl-CoA}} | |
− | + | {{#set: inchi key=InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J}} | |
− | + | {{#set: molecular weight=861.604 }} | |
− | + | {{#set: reversible reaction associated=RXN-12560|RXN-12561}} | |
− | + | ||
− | {{#set: smiles=C(C( | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: molecular weight= | + | |
− | + | ||
− | {{#set: reversible reaction associated=RXN- | + |
Latest revision as of 19:34, 21 March 2018
Contents
Metabolite CPD-13534
- smiles:
- CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- β-ketovaleryl-CoA
- inchi key:
- InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J
- molecular weight:
- 861.604
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.