Difference between revisions of "CPD0-1718"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_1718 == * left end position: ** 4302 * transcription direction: ** POSITIVE * right end position: ** 8544 * centisome position: ** 19.48104...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == * smiles: ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) * common name: ** 7,8-dihyd...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_1718 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] ==
* left end position:
+
* smiles:
** 4302
+
** C1(=NC2(=C(NC1)N=C(N)NC(=O)2))
* transcription direction:
+
* common name:
** POSITIVE
+
** 7,8-dihydropterin
* right end position:
+
* inchi key:
** 8544
+
** InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N
* centisome position:
+
* molecular weight:
** 19.481049    
+
** 165.154    
 
* Synonym(s):
 
* Synonym(s):
 +
** dihydropterin
 +
** H2-pterin
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.4.21.83-RXN]]
+
* [[RXN-15261]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=4302}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65260 65260]
{{#set: right end position=8544}}
+
* CHEMSPIDER:
{{#set: centisome position=19.481049   }}
+
** [http://www.chemspider.com/Chemical-Structure.58752.html 58752]
{{#set: reaction associated=3.4.21.83-RXN}}
+
{{#set: smiles=C1(=NC2(=C(NC1)N=C(N)NC(=O)2))}}
 +
{{#set: common name=7,8-dihydropterin}}
 +
{{#set: inchi key=InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=165.154   }}
 +
{{#set: common name=dihydropterin|H2-pterin}}
 +
{{#set: consumed by=RXN-15261}}

Latest revision as of 19:35, 21 March 2018

Metabolite CPD0-1718

  • smiles:
    • C1(=NC2(=C(NC1)N=C(N)NC(=O)2))
  • common name:
    • 7,8-dihydropterin
  • inchi key:
    • InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N
  • molecular weight:
    • 165.154
  • Synonym(s):
    • dihydropterin
    • H2-pterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links