Difference between revisions of "Tiso gene 8508"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(...")
(Created page with "Category:Gene == Gene Tiso_gene_8508 == * right end position: ** 9564 * transcription direction: ** NEGATIVE * left end position: ** 7229 * centisome position: ** 70.9839...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] ==
+
== Gene Tiso_gene_8508 ==
−
* smiles:
+
* right end position:
−
** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
** 9564
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 15,16-dihydrobiliverdin
+
** 7229
−
* molecular weight:
+
* centisome position:
−
** 582.655    
+
** 70.9839    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.3.7.3-RXN]]
+
* Reaction: [[GSHTRAN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[GST-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-13673]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-15680]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=9564}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=7229}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899]
+
{{#set: centisome position=70.9839    }}
−
{{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
−
{{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}}
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
−
{{#set: common name=15,16-dihydrobiliverdin}}
+
−
{{#set: molecular weight=582.655    }}
+
−
{{#set: consumed by=1.3.7.3-RXN}}
+

Latest revision as of 20:35, 21 March 2018

Gene Tiso_gene_8508

  • right end position:
    • 9564
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 7229
  • centisome position:
    • 70.9839
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8508&oldid=42534"