Difference between revisions of "ALLYSINE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7085 PWY-7085] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * smiles: ** [CH](=O)CCCC([N+])C(=O)[O-] * common name: ** (S)-2-amino-6-...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == |
− | * | + | * smiles: |
− | ** [ | + | ** [CH](=O)CCCC([N+])C(=O)[O-] |
* common name: | * common name: | ||
− | ** | + | ** (S)-2-amino-6-oxohexanoate |
+ | * inchi key: | ||
+ | ** InChIKey=GFXYTQPNNXGICT-YFKPBYRVSA-N | ||
+ | * molecular weight: | ||
+ | ** 145.158 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** allysine | ||
+ | ** L-2-aminoadipate 6-semialdehyde | ||
+ | ** 2-aminoadipate 6-semialdehyde | ||
+ | ** α-aminoadipate 6-semialdehyde | ||
+ | ** 2-aminoadipate semialdehyde | ||
+ | ** L-allysine | ||
+ | ** (S)-2-aminoadipate 6-semialdehyde | ||
+ | ** 2-aminoadipate-6-semialdehyde | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[1.2.1.31-RXN]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[1.5.1.9-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[ALLYSINE-DEHYDROG-RXN]] | |
− | + | * [[RXN-8173]] | |
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | * [ | + | |
− | + | ||
− | + | ||
− | * [ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 1962-83-0 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688062 36688062] |
− | {{#set: | + | * HMDB : HMDB59595 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04076 C04076] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58321 58321] | ||
+ | * METABOLIGHTS : MTBLC58321 | ||
+ | {{#set: smiles=[CH](=O)CCCC([N+])C(=O)[O-]}} | ||
+ | {{#set: common name=(S)-2-amino-6-oxohexanoate}} | ||
+ | {{#set: inchi key=InChIKey=GFXYTQPNNXGICT-YFKPBYRVSA-N}} | ||
+ | {{#set: molecular weight=145.158 }} | ||
+ | {{#set: common name=allysine|L-2-aminoadipate 6-semialdehyde|2-aminoadipate 6-semialdehyde|α-aminoadipate 6-semialdehyde|2-aminoadipate semialdehyde|L-allysine|(S)-2-aminoadipate 6-semialdehyde|2-aminoadipate-6-semialdehyde}} | ||
+ | {{#set: consumed by=1.2.1.31-RXN}} | ||
+ | {{#set: produced by=1.5.1.9-RXN}} | ||
+ | {{#set: reversible reaction associated=ALLYSINE-DEHYDROG-RXN|RXN-8173}} |
Latest revision as of 19:35, 21 March 2018
Contents
Metabolite ALLYSINE
- smiles:
- [CH](=O)CCCC([N+])C(=O)[O-]
- common name:
- (S)-2-amino-6-oxohexanoate
- inchi key:
- InChIKey=GFXYTQPNNXGICT-YFKPBYRVSA-N
- molecular weight:
- 145.158
- Synonym(s):
- allysine
- L-2-aminoadipate 6-semialdehyde
- 2-aminoadipate 6-semialdehyde
- α-aminoadipate 6-semialdehyde
- 2-aminoadipate semialdehyde
- L-allysine
- (S)-2-aminoadipate 6-semialdehyde
- 2-aminoadipate-6-semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1962-83-0
- PUBCHEM:
- HMDB : HMDB59595
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58321
"CH](=O)CCCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.