Difference between revisions of "RXN-6384"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6384 RXN-6384] == * direction: ** LEFT-TO-RIGHT * common name: ** enoyl-_hydratase * ec number:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6384 RXN-6384] ==
−
* smiles:
+
* direction:
−
** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N
+
 
* common name:
 
* common name:
−
** D-galactono-1,4-lactone
+
** enoyl-_hydratase
−
* molecular weight:
+
* ec number:
−
** 178.141   
+
** [http://enzyme.expasy.org/EC/3.1.2.4 EC-3.1.2.4]
 
* Synonym(s):
 
* Synonym(s):
−
** D-galactonate-γ-lactone
 
−
** galactono-γ-lactone
 
−
** D-galactonolactone
 
−
** D-galactono-γ-lactone
 
−
** D-galactonic acid γ-lactone
 
−
** γ-D-galactonolactone
 
−
** D-(-)-galactonic acid γ-lactone
 
−
** D-galactonic acid g-lactone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[GALACTONOLACTONASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[3-HYDROXY-PROPIONYL-COA]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[3-HYDROXY-PROPIONATE]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 3-hydroxypropanoyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 3-hydroxypropanoate[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2224]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7574]], propanoyl-CoA degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7574 PWY-7574]
 +
** '''3''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-3941]], β-alanine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3941 PWY-3941]
 +
** '''2''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2782-07-2
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R03158 R03158]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=97165 97165]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB02541
+
{{#set: common name=enoyl-_hydratase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-3.1.2.4}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03383 C03383]
+
{{#set: gene associated=Tiso_gene_2224}}
−
* CHEMSPIDER:
+
{{#set: in pathway=PWY-7574|PWY-3941}}
−
** [http://www.chemspider.com/Chemical-Structure.92162.html 92162]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15895 15895]
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}}
+
−
{{#set: inchi key=InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N}}
+
−
{{#set: common name=D-galactono-1,4-lactone}}
+
−
{{#set: molecular weight=178.141    }}
+
−
{{#set: common name=D-galactonate-γ-lactone|galactono-γ-lactone|D-galactonolactone|D-galactono-γ-lactone|D-galactonic acid γ-lactone|γ-D-galactonolactone|D-(-)-galactonic acid γ-lactone|D-galactonic acid g-lactone}}
+
−
{{#set: consumed by=GALACTONOLACTONASE-RXN}}
+

Latest revision as of 19:35, 21 March 2018

Reaction RXN-6384

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • enoyl-_hydratase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7574, propanoyl-CoA degradation II: PWY-7574
    • 3 reactions found over 5 reactions in the full pathway
  • PWY-3941, β-alanine biosynthesis II: PWY-3941
    • 2 reactions found over 6 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-6384&oldid=42604"