Difference between revisions of "CPD-4126"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1329 PWY0-1329] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1329 PWY0-1329] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
** succinate to cytochrome bo oxidase electron transfer
+
** 5-dehydroavenasterol
 +
* inchi key:
 +
** InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N
 +
* molecular weight:
 +
** 410.682   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-4210]]
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
+
== Reaction(s) known to produce the compound ==
** 0 associated gene:
+
* [[RXN-4209]]
** 1 reconstruction source(s) associated:
+
== Reaction(s) of unknown directionality ==
*** [[manual-primary_network]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5268 RXN0-5268]
+
 
== External links  ==
 
== External links  ==
* ECOCYC:
+
* PUBCHEM:
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1329 PWY0-1329]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263331 44263331]
{{#set: taxonomic range=TAX-2}}
+
* HMDB : HMDB06852
{{#set: common name=succinate to cytochrome bo oxidase electron transfer}}
+
* CHEBI:
{{#set: reaction found=1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80097 80097]
{{#set: total reaction=2}}
+
* LIGAND-CPD:
{{#set: completion rate=50.0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15783 C15783]
 +
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=5-dehydroavenasterol}}
 +
{{#set: inchi key=InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N}}
 +
{{#set: molecular weight=410.682    }}
 +
{{#set: consumed by=RXN-4210}}
 +
{{#set: produced by=RXN-4209}}

Latest revision as of 19:35, 21 March 2018

Metabolite CPD-4126

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 5-dehydroavenasterol
  • inchi key:
    • InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N
  • molecular weight:
    • 410.682
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.