Difference between revisions of "GLYCEROL-KIN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] == * smiles: ** CC(=O)C(O)C(O)COP([O-])(=O)[O-] * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-KIN-RXN GLYCEROL-KIN-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.exp...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-KIN-RXN GLYCEROL-KIN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.30 EC-2.7.1.30] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[GLYCEROL]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[GLYCEROL-3P]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 glycerol[c] '''+''' 1 ATP[c] '''<=>''' 1 H+[c] '''+''' 1 ADP[c] '''+''' 1 sn-glycerol 3-phosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_12434]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_16670]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways == | ||
+ | * [[PWY-4261]], glycerol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4261 PWY-4261] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21644 21644] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00847 R00847] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P18157 P18157] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P47284 P47284] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9CG64 Q9CG64] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9V207 Q9V207] |
− | * | + | ** [http://www.uniprot.org/uniprot/P44400 P44400] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9WX53 Q9WX53] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M0X5 Q7M0X5] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0A6F3 P0A6F3] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P25013 P25013] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P19255 P19255] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P32190 P32190] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P32189 P32189] |
+ | ** [http://www.uniprot.org/uniprot/P95907 P95907] | ||
+ | ** [http://www.uniprot.org/uniprot/Q49011 Q49011] | ||
+ | ** [http://www.uniprot.org/uniprot/O93623 O93623] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: ec number=EC-2.7.1.30}} | ||
+ | {{#set: gene associated=Tiso_gene_12434|Tiso_gene_16670}} | ||
+ | {{#set: in pathway=PWY-4261}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-athaliana|orthology-creinhardtii|orthology-synechocystis|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 19:36, 21 March 2018
Contents
Reaction GLYCEROL-KIN-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 GLYCEROL[c] + 1 ATP[c] <=> 1 PROTON[c] + 1 ADP[c] + 1 GLYCEROL-3P[c]
- With common name(s):
- 1 glycerol[c] + 1 ATP[c] <=> 1 H+[c] + 1 ADP[c] + 1 sn-glycerol 3-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_12434
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Gene: Tiso_gene_16670
- Source: orthology-synechocystis
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: