Difference between revisions of "RXN-15041"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15041 RXN-15041] == * direction: ** LEFT-TO-RIGHT * common name: ** d-aminoacyl-trna_deacylase...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15041 RXN-15041] ==
* smiles:
+
* direction:
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N
+
 
* common name:
 
* common name:
** 6-hydroxytyphasterol
+
** d-aminoacyl-trna_deacylase
* molecular weight:
+
* ec number:
** 450.701   
+
** [http://enzyme.expasy.org/EC/3.1.1.96 EC-3.1.1.96]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-4241]]
+
** 1 [[WATER]][c] '''+''' 1 [[D-aminoacyl-tRNAs]][c] '''=>''' 1 [[D-Amino-Acids]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[tRNAs]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 a D-aminoacyl-[tRNA][c] '''=>''' 1 a D-amino acid[c] '''+''' 1 H+[c] '''+''' 1 an uncharged tRNA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11763]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515372 102515372]
+
{{#set: common name=d-aminoacyl-trna_deacylase}}
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: ec number=EC-3.1.1.96}}
{{#set: inchi key=InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N}}
+
{{#set: gene associated=Tiso_gene_11763}}
{{#set: common name=6-hydroxytyphasterol}}
+
{{#set: in pathway=}}
{{#set: molecular weight=450.701    }}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: produced by=RXN-4241}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:37, 21 March 2018

Reaction RXN-15041

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • d-aminoacyl-trna_deacylase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links