|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.21.4-RXN 3.4.21.4-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C |
| * common name: | | * common name: |
− | ** trypsin_family | + | ** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol |
− | ** trypsin | + | * inchi key: |
− | * ec number: | + | ** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M |
− | ** [http://enzyme.expasy.org/EC/3.4.21.4 EC-3.4.21.4] | + | * molecular weight: |
| + | ** 443.688 |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN66-18]] |
− | ** 1 [[WATER]][c] '''+''' 1 [[General-Protein-Substrates]][c] '''=>''' 1 [[Peptides-holder]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 H2O[c] '''+''' 1 a protein[c] '''=>''' 1 a peptide[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_4842]] | + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_8820]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_2777]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_13074]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_1341]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_12875]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_4147]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_17883]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_1761]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_1997]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_19324]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_20549]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_13684]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways == | + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * UNIPROT: | + | * PUBCHEM: |
− | ** [http://www.uniprot.org/uniprot/P07477 P07477] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826592 91826592] |
− | ** [http://www.uniprot.org/uniprot/P08426 P08426]
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P35051 P35051]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87047 87047] |
− | ** [http://www.uniprot.org/uniprot/P19799 P19799] | + | * HMDB : HMDB12165 |
− | ** [http://www.uniprot.org/uniprot/Q7M434 Q7M434] | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}} |
− | ** [http://www.uniprot.org/uniprot/Q7M435 Q7M435]
| + | {{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}} |
− | ** [http://www.uniprot.org/uniprot/Q7M390 Q7M390]
| + | {{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}} |
− | ** [http://www.uniprot.org/uniprot/Q7LZP8 Q7LZP8] | + | {{#set: molecular weight=443.688 }} |
− | ** [http://www.uniprot.org/uniprot/Q7LZF8 Q7LZF8]
| + | {{#set: consumed by=RXN66-18}} |
− | ** [http://www.uniprot.org/uniprot/Q7M433 Q7M433]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07146 P07146]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07478 P07478]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M3N1 Q7M3N1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M432 Q7M432]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32821 P32821]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32822 P32822]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12788 P12788]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35050 P35050]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q29463 Q29463]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35034 P35034]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35031 P35031]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35032 P35032]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35033 P35033]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35030 P35030]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35035 P35035]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35036 P35036]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16049 P16049]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q91041 Q91041]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35038 P35038]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35041 P35041]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35037 P35037]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q92099 Q92099]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27761 Q27761]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90629 Q90629]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90628 Q90628]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90627 Q90627]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M436 Q7M436]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35045 P35045]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00765 P00765]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00764 P00764]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06872 P06872]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06871 P06871]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00761 P00761]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00762 P00762]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00763 P00763]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00775 P00775]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}}
| + | |
− | {{#set: common name=trypsin_family}} | + | |
− | {{#set: common name=trypsin}}
| + | |
− | {{#set: ec number=EC-3.4.21.4}}
| + | |
− | {{#set: gene associated=Tiso_gene_4842|Tiso_gene_8820|Tiso_gene_2777|Tiso_gene_13074|Tiso_gene_1341|Tiso_gene_12875|Tiso_gene_4147|Tiso_gene_17883|Tiso_gene_1761|Tiso_gene_1997|Tiso_gene_19324|Tiso_gene_20549|Tiso_gene_13684}} | + | |
− | {{#set: in pathway=}}
| + | |
− | {{#set: reconstruction category=orthology|annotation}} | + | |
− | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |