Difference between revisions of "CPD-14808"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * common name: ** scyllo-inosose...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C(C(C(C(C1O)O)=O)O)O)O | ** C1(C(C(C(C(C1O)O)=O)O)O)O | ||
| − | |||
| − | |||
* common name: | * common name: | ||
** scyllo-inosose | ** scyllo-inosose | ||
| + | * inchi key: | ||
| + | ** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N | ||
* molecular weight: | * molecular weight: | ||
** 178.141 | ** 178.141 | ||
| Line 25: | Line 25: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811] | ||
{{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}} | {{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}} | ||
| − | |||
{{#set: common name=scyllo-inosose}} | {{#set: common name=scyllo-inosose}} | ||
| + | {{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}} | ||
{{#set: molecular weight=178.141 }} | {{#set: molecular weight=178.141 }} | ||
{{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}} | {{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}} | ||
{{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN}} | {{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN}} | ||
Latest revision as of 19:37, 21 March 2018
Contents
Metabolite CPD-14808
- smiles:
- C1(C(C(C(C(C1O)O)=O)O)O)O
- common name:
- scyllo-inosose
- inchi key:
- InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
- molecular weight:
- 178.141
- Synonym(s):
- 2-keto-myo-inositol
- 2,4,6/3,5-pentahydroxycyclohexanone
- 2-inosose
- 2-keto-scyllo-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
