Difference between revisions of "5-HYDROXY-CONIFERALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CONIFERALDEHYDE 5-HYDROXY-CONIFERALDEHYDE] == * smiles: ** COC1(=CC(C=CC=O)=CC(O)=C(O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CONIFERALDEHYDE 5-HYDROXY-CONIFERALDEHYDE] == * smiles: ** COC1(=CC(C=CC=O)=CC(O)=C(O...") |
||
(One intermediate revision by the same user not shown) | |||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** COC1(=CC(C=CC=O)=CC(O)=C(O)1) | ** COC1(=CC(C=CC=O)=CC(O)=C(O)1) | ||
− | |||
− | |||
* common name: | * common name: | ||
** 5-hydroxy-coniferaldehyde | ** 5-hydroxy-coniferaldehyde | ||
+ | * inchi key: | ||
+ | ** InChIKey=IEHPLRVWOHZKCS-NSCUHMNNSA-N | ||
* molecular weight: | * molecular weight: | ||
** 194.187 | ** 194.187 | ||
Line 25: | Line 25: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C12204 C12204] | ** [http://www.genome.jp/dbget-bin/www_bget?C12204 C12204] | ||
{{#set: smiles=COC1(=CC(C=CC=O)=CC(O)=C(O)1)}} | {{#set: smiles=COC1(=CC(C=CC=O)=CC(O)=C(O)1)}} | ||
− | |||
{{#set: common name=5-hydroxy-coniferaldehyde}} | {{#set: common name=5-hydroxy-coniferaldehyde}} | ||
+ | {{#set: inchi key=InChIKey=IEHPLRVWOHZKCS-NSCUHMNNSA-N}} | ||
{{#set: molecular weight=194.187 }} | {{#set: molecular weight=194.187 }} | ||
{{#set: consumed by=RXN-1143}} | {{#set: consumed by=RXN-1143}} |
Latest revision as of 19:37, 21 March 2018
Contents
Metabolite 5-HYDROXY-CONIFERALDEHYDE
- smiles:
- COC1(=CC(C=CC=O)=CC(O)=C(O)1)
- common name:
- 5-hydroxy-coniferaldehyde
- inchi key:
- InChIKey=IEHPLRVWOHZKCS-NSCUHMNNSA-N
- molecular weight:
- 194.187
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links