Difference between revisions of "PWY-735"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
+
 
* common name:
 
* common name:
−
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
+
** jasmonic acid biosynthesis
−
* molecular weight:
+
−
** 442.724   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** jasmonate biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN66-13]]
+
'''15''' reactions found over '''19''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-10695]]
−
* [[RXN66-12]]
+
** 2 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_14183]]
 +
*** [[Tiso_gene_12275]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-10696]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_18566]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-10697]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_16145]]
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_6885]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-10698]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_14026]]
 +
*** [[Tiso_gene_14027]]
 +
*** [[Tiso_gene_5857]]
 +
*** [[Tiso_gene_18839]]
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_18838]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-10699]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_3855]]
 +
*** [[Tiso_gene_17451]]
 +
*** [[Tiso_gene_15327]]
 +
*** [[Tiso_gene_10116]]
 +
*** [[Tiso_gene_3856]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-10700]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_15327]]
 +
*** [[Tiso_gene_10116]]
 +
*** [[Tiso_gene_3855]]
 +
*** [[Tiso_gene_17451]]
 +
*** [[Tiso_gene_3856]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-10701]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_3855]]
 +
*** [[Tiso_gene_10116]]
 +
*** [[Tiso_gene_17451]]
 +
*** [[Tiso_gene_3856]]
 +
*** [[Tiso_gene_15327]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-10702]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_18838]]
 +
*** [[Tiso_gene_5857]]
 +
*** [[Tiso_gene_18839]]
 +
*** [[Tiso_gene_14027]]
 +
*** [[Tiso_gene_14026]]
 +
*** [[Tiso_gene_14262]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-10703]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_18838]]
 +
*** [[Tiso_gene_5857]]
 +
*** [[Tiso_gene_18839]]
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_14027]]
 +
*** [[Tiso_gene_14026]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-10704]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_16145]]
 +
*** [[Tiso_gene_6885]]
 +
*** [[Tiso_gene_14262]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-10705]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_16145]]
 +
*** [[Tiso_gene_6885]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-10706]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_18566]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-10707]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_18566]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-10708]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_10984]]
 +
*** [[Tiso_gene_801]]
 +
*** [[Tiso_gene_7477]]
 +
*** [[Tiso_gene_800]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-1321]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_4463]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=12-OXOPHYTODIENOATE-REDUCTASE-RXN 12-OXOPHYTODIENOATE-REDUCTASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ALLENE-OXIDE-CYCLASE-RXN ALLENE-OXIDE-CYCLASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-745 RXN-745]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-19 RXN1F-19]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698824 15698824]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-735 PWY-735]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87060 87060]
+
{{#set: common name=jasmonic acid biosynthesis}}
−
* HMDB : HMDB12159
+
{{#set: common name=jasmonate biosynthesis}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: reaction found=15}}
−
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
+
{{#set: total reaction=19}}
−
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: completion rate=79.0}}
−
{{#set: molecular weight=442.724    }}
+
−
{{#set: consumed by=RXN66-13}}
+
−
{{#set: produced by=RXN66-12}}
+

Latest revision as of 19:37, 21 March 2018

Pathway PWY-735

  • taxonomic range:
  • common name:
    • jasmonic acid biosynthesis
  • Synonym(s):
    • jasmonate biosynthesis

Reaction(s) found

15 reactions found over 19 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-735&oldid=42833"