Difference between revisions of "PWY-6608"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * smiles: ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6608 PWY-6608] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6608 PWY-6608] ==
* smiles:
+
* taxonomic range:
** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
** InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
+
 
* common name:
 
* common name:
** GDP-β-L-fucose
+
** guanosine nucleotides degradation III
* molecular weight:
+
** 587.33   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''4''' reactions in the full pathway
* [[1.1.1.271-RXN]]
+
* [[GUANINE-DEAMINASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_12280]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN-7609]]
 +
** 8 associated gene(s):
 +
*** [[Tiso_gene_5911]]
 +
*** [[Tiso_gene_13929]]
 +
*** [[Tiso_gene_6640]]
 +
*** [[Tiso_gene_9166]]
 +
*** [[Tiso_gene_14435]]
 +
*** [[Tiso_gene_14434]]
 +
*** [[Tiso_gene_6988]]
 +
*** [[Tiso_gene_14246]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN0-901]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_11775]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5199 RXN0-5199]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244478 25244478]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6608 PWY-6608]
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57273 57273]
+
{{#set: taxonomic range=TAX-33208}}
{{#set: smiles=CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)}}
+
{{#set: common name=guanosine nucleotides degradation III}}
{{#set: inchi key=InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L}}
+
{{#set: reaction found=3}}
{{#set: common name=GDP-β-L-fucose}}
+
{{#set: total reaction=4}}
{{#set: molecular weight=587.33    }}
+
{{#set: completion rate=75.0}}
{{#set: produced by=1.1.1.271-RXN}}
+

Latest revision as of 19:37, 21 March 2018

Pathway PWY-6608

  • taxonomic range:
  • common name:
    • guanosine nucleotides degradation III
  • Synonym(s):

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links