Difference between revisions of "CPD-10608"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHYLMALONYL-COA-MUT-RXN METHYLMALONYL-COA-MUT-RXN] == * direction: ** REVERSIBLE * common name: *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * smiles: ** C1(=CC(=O)OC(=CC(=O)[O-])1) * common name: ** trans-dienel...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHYLMALONYL-COA-MUT-RXN METHYLMALONYL-COA-MUT-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C1(=CC(=O)OC(=CC(=O)[O-])1)
 
* common name:
 
* common name:
−
** methylmalonyl-_mitochondrial
+
** trans-dienelactone
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/5.4.99.2 EC-5.4.99.2]
+
** InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M
 +
* molecular weight:
 +
** 139.087   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-trans-dienelactone
 +
** trans-4-carboxymethylenebut-2-en-1,4-olide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-9868]]
−
** 1 [[METHYL-MALONYL-COA]][c] '''<=>''' 1 [[SUC-COA]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 (R)-methylmalonyl-CoA[c] '''<=>''' 1 succinyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_9771]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY0-43]], conversion of succinate to propanoate: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-43 PWY0-43]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-7384]], anaerobic energy metabolism (invertebrates, mitochondrial): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7384 PWY-7384]
+
−
** '''7''' reactions found over '''12''' reactions in the full pathway
+
−
* [[PWY-5743]], 3-hydroxypropanoate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5743 PWY-5743]
+
−
** '''4''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-6728]], methylaspartate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728]
+
−
** '''11''' reactions found over '''18''' reactions in the full pathway
+
−
* [[PROPIONMET-PWY]], propanoyl CoA degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PROPIONMET-PWY PROPIONMET-PWY]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-5789]], 3-hydroxypropanoate/4-hydroxybutanate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5789 PWY-5789]
+
−
** '''8''' reactions found over '''16''' reactions in the full pathway
+
−
* [[P108-PWY]], pyruvate fermentation to propanoate I: [http://metacyc.org/META/NEW-IMAGE?object=P108-PWY P108-PWY]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22888 22888]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543248 9543248]
−
* LIGAND-RXN:
+
* CHEMSPIDER:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00833 R00833]
+
** [http://www.chemspider.com/Chemical-Structure.7822189.html 7822189]
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/Q05064 Q05064]
+
** [http://www.genome.jp/dbget-bin/www_bget?C12838 C12838]
−
** [http://www.uniprot.org/uniprot/P22033 P22033]
+
{{#set: smiles=C1(=CC(=O)OC(=CC(=O)[O-])1)}}
−
** [http://www.uniprot.org/uniprot/Q05065 Q05065]
+
{{#set: common name=trans-dienelactone}}
−
** [http://www.uniprot.org/uniprot/O74009 O74009]
+
{{#set: inchi key=InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M}}
−
** [http://www.uniprot.org/uniprot/Q9YBB0 Q9YBB0]
+
{{#set: molecular weight=139.087    }}
−
** [http://www.uniprot.org/uniprot/Q9V0E8 Q9V0E8]
+
{{#set: common name=2-trans-dienelactone|trans-4-carboxymethylenebut-2-en-1,4-olide}}
−
** [http://www.uniprot.org/uniprot/Q9RV41 Q9RV41]
+
{{#set: consumed by=RXN-9868}}
−
** [http://www.uniprot.org/uniprot/O28068 O28068]
+
−
** [http://www.uniprot.org/uniprot/Q59676 Q59676]
+
−
** [http://www.uniprot.org/uniprot/Q59677 Q59677]
+
−
** [http://www.uniprot.org/uniprot/P11652 P11652]
+
−
** [http://www.uniprot.org/uniprot/P11653 P11653]
+
−
** [http://www.uniprot.org/uniprot/P16332 P16332]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: common name=methylmalonyl-_mitochondrial}}
+
−
{{#set: ec number=EC-5.4.99.2}}
+
−
{{#set: gene associated=Tiso_gene_9771}}
+
−
{{#set: in pathway=PWY0-43|PWY-7384|PWY-5743|PWY-6728|PROPIONMET-PWY|PWY-5789|P108-PWY}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:38, 21 March 2018

Metabolite CPD-10608

  • smiles:
    • C1(=CC(=O)OC(=CC(=O)[O-])1)
  • common name:
    • trans-dienelactone
  • inchi key:
    • InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M
  • molecular weight:
    • 139.087
  • Synonym(s):
    • 2-trans-dienelactone
    • trans-4-carboxymethylenebut-2-en-1,4-olide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(=CC(=O)OC(=CC(=O)[O-])1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-10608&oldid=42937"