Difference between revisions of "RXN-18301"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * smiles: ** C1(=CC(=O)OC(=CC(=O)[O-])1) * inchi key: ** InChIKey=AYFXP...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18301 RXN-18301] == * direction: ** LEFT-TO-RIGHT * common name: ** galactose-3-o-sulfotransfer...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18301 RXN-18301] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** galactose-3-o-sulfotransferase_2-like |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.8.2.11 EC-2.8.2.11] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[A-GALACTOSYLCERAMIDE]][c] '''+''' 1 [[PAPS]][c] '''=>''' 1 [[galactosylceramide-sulfate]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-5-ADP]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 a β-D-galactosyl-N-acylsphingosine[c] '''+''' 1 3'-phosphoadenylyl-sulfate[c] '''=>''' 1 a galactosylceramide sulfate[c] '''+''' 1 H+[c] '''+''' 1 adenosine 3',5'-bisphosphate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_13030]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWY-7840]], gala-series glycosphingolipids biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7840 PWY-7840] | ||
| + | ** '''3''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=galactose-3-o-sulfotransferase_2-like}} | |
| − | + | {{#set: ec number=EC-2.8.2.11}} | |
| − | + | {{#set: gene associated=Tiso_gene_13030}} | |
| − | + | {{#set: in pathway=PWY-7840}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:38, 21 March 2018
Contents
Reaction RXN-18301
- direction:
- LEFT-TO-RIGHT
- common name:
- galactose-3-o-sulfotransferase_2-like
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 A-GALACTOSYLCERAMIDE[c] + 1 PAPS[c] => 1 galactosylceramide-sulfate[c] + 1 PROTON[c] + 1 3-5-ADP[c]
- With common name(s):
- 1 a β-D-galactosyl-N-acylsphingosine[c] + 1 3'-phosphoadenylyl-sulfate[c] => 1 a galactosylceramide sulfate[c] + 1 H+[c] + 1 adenosine 3',5'-bisphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13030
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7840, gala-series glycosphingolipids biosynthesis: PWY-7840
- 3 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
