Difference between revisions of "D-GLT"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17795 RXN-17795] == * direction: ** LEFT-TO-RIGHT * common name: ** thiolase ** 3-ketoacyl-_thi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * common name: ** D-glutamate * inch...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == |
− | * | + | * smiles: |
− | ** | + | ** C(CCC(C(=O)[O-])[N+])([O-])=O |
* common name: | * common name: | ||
− | ** | + | ** D-glutamate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 146.122 |
* Synonym(s): | * Synonym(s): | ||
+ | ** D-glutamic acid | ||
+ | ** D-glu | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[D-ALANINE-AMINOTRANSFERASE-RXN]] | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CAS : 6893-26-1 | |
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460297 5460297] | |
− | + | * HMDB : HMDB03339 | |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00217 C00217] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29986 29986] |
− | {{#set: | + | * BIGG : glu__D |
− | {{#set: | + | {{#set: smiles=C(CCC(C(=O)[O-])[N+])([O-])=O}} |
+ | {{#set: common name=D-glutamate}} | ||
+ | {{#set: inchi key=InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M}} | ||
+ | {{#set: molecular weight=146.122 }} | ||
+ | {{#set: common name=D-glutamic acid|D-glu}} | ||
+ | {{#set: reversible reaction associated=D-ALANINE-AMINOTRANSFERASE-RXN}} |
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite D-GLT
- smiles:
- C(CCC(C(=O)[O-])[N+])([O-])=O
- common name:
- D-glutamate
- inchi key:
- InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M
- molecular weight:
- 146.122
- Synonym(s):
- D-glutamic acid
- D-glu
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CCC(C(=O)[O-])[N+])([O-])=O" cannot be used as a page name in this wiki.