Difference between revisions of "PWY1F-823"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C * inchi key: ** InCh...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-823 PWY1F-823] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-823 PWY1F-823] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** leucopelargonidin and leucocyanidin biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''3''' reactions found over '''4''' reactions in the full pathway |
| − | + | * [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]] | |
| − | == Reaction(s) | + | ** 4 associated gene(s): |
| + | *** [[Tiso_gene_15272]] | ||
| + | *** [[Tiso_gene_9504]] | ||
| + | *** [[Tiso_gene_9503]] | ||
| + | *** [[Tiso_gene_11016]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-600]] | ||
| + | ** 4 associated gene(s): | ||
| + | *** [[Tiso_gene_15272]] | ||
| + | *** [[Tiso_gene_11016]] | ||
| + | *** [[Tiso_gene_9503]] | ||
| + | *** [[Tiso_gene_9504]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-7775]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_3330]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-525 RXN-525] | ||
== External links == | == External links == | ||
| − | * | + | * ARACYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY1F-823 PWY1F-823] |
| − | + | {{#set: taxonomic range=TAX-58024}} | |
| − | + | {{#set: common name=leucopelargonidin and leucocyanidin biosynthesis}} | |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=75.0}} | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:27, 21 March 2018
Pathway PWY1F-823
- taxonomic range:
- common name:
- leucopelargonidin and leucocyanidin biosynthesis
- Synonym(s):
Reaction(s) found
3 reactions found over 4 reactions in the full pathway
- DIHYDROKAEMPFEROL-4-REDUCTASE-RXN
- 4 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-600
- 4 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-7775
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC:
