Difference between revisions of "AMP5N"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXY-D-RIBOSE-1-PHOSPHATE DEOXY-D-RIBOSE-1-PHOSPHATE] == * smiles: ** C1(C(O)C(CO)OC1OP(=O)([O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMP5N AMP5N] == * direction: ** LEFT-TO-RIGHT * common name: ** AMP-5'-nucleotidase * Synonym(s):...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXY-D-RIBOSE-1-PHOSPHATE DEOXY-D-RIBOSE-1-PHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMP5N AMP5N] ==
* smiles:
+
* direction:
** C1(C(O)C(CO)OC1OP(=O)([O-])[O-])
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=KBDKAJNTYKVSEK-VPENINKCSA-L
+
 
* common name:
 
* common name:
** 2-deoxy-α-D-ribose 1-phosphate
+
** AMP-5'-nucleotidase
* molecular weight:
+
** 212.096   
+
 
* Synonym(s):
 
* Synonym(s):
** deoxy-D-ribose 1-phosphate
 
** 2-deoxy-D-ribose-1-phosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[AMP]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[ADENOSINE]][c]
* [[THYM-PHOSPH-RXN]]
+
* With common name(s):
* [[URA-PHOSPH-RXN]]
+
** 1.0 H2O[c] '''+''' 1.0 AMP[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 adenosine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9166]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_6988]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23419734 23419734]
+
{{#set: common name=AMP-5'-nucleotidase}}
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_9166|Tiso_gene_6988}}
** [http://www.chemspider.com/Chemical-Structure.10461471.html 10461471]
+
{{#set: in pathway=}}
* CHEBI:
+
{{#set: reconstruction category=orthology}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57259 57259]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* BIGG : 2dr1p
+
{{#set: reconstruction tool=pantograph}}
* HMDB : HMDB01351
+
{{#set: smiles=C1(C(O)C(CO)OC1OP(=O)([O-])[O-])}}
+
{{#set: inchi key=InChIKey=KBDKAJNTYKVSEK-VPENINKCSA-L}}
+
{{#set: common name=2-deoxy-α-D-ribose 1-phosphate}}
+
{{#set: molecular weight=212.096    }}
+
{{#set: common name=deoxy-D-ribose 1-phosphate|2-deoxy-D-ribose-1-phosphate}}
+
{{#set: reversible reaction associated=THYM-PHOSPH-RXN|URA-PHOSPH-RXN}}
+

Latest revision as of 19:40, 21 March 2018

Reaction AMP5N

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • AMP-5'-nucleotidase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 AMP[c] => 1.0 phosphate[c] + 1.0 adenosine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links