Difference between revisions of "PWY-5965"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5965 PWY-5965] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5965 PWY-5965] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
+
 
* common name:
 
* common name:
** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
+
** fatty acid biosynthesis initiation III
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-14]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
* [[RXN66-13]]
+
** 9 associated gene(s):
* [[RXN-13707]]
+
*** [[Tiso_gene_5939]]
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_14485]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_15991]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_19302]]
 +
*** [[Tiso_gene_10876]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-ACPDECARBOX-RXN MALONYL-ACPDECARBOX-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167817 167817]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5965 PWY-5965]
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78904 78904]
+
{{#set: common name=fatty acid biosynthesis initiation III}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}}
+
{{#set: reaction found=1}}
{{#set: inchi key=InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N}}
+
{{#set: total reaction=2}}
{{#set: common name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}}
+
{{#set: completion rate=50.0}}
{{#set: molecular weight=412.698    }}
+
{{#set: consumed by=RXN66-14}}
+
{{#set: produced by=RXN66-13|RXN-13707}}
+

Latest revision as of 19:40, 21 March 2018

Pathway PWY-5965

  • taxonomic range:
  • common name:
    • fatty acid biosynthesis initiation III
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links