Difference between revisions of "CPD-15526"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12997 RXN-12997] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] == * smiles: ** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3)) * common name:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12997 RXN-12997] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.3.1.93 EC-1.3.1.93]
+
** cyclobutadipyrimidine
 +
* inchi key:
 +
** InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 238.246   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[CPD-14420]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[CPD-12647]][c]
+
* [[3.2.2.17-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 icosatrienoyl-2-enoyl CoA[c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 (11Z,14Z,17Z)-icosa-11,14,17-trienoyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7602]], icosapentaenoate biosynthesis V (8-desaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7602 PWY-7602]
+
−
** '''7''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7619]], juniperonate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7619 PWY-7619]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7724]], icosapentaenoate biosynthesis III (8-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7724 PWY-7724]
+
−
** '''5''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.3.1.93}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659235 90659235]
−
{{#set: in pathway=PWY-7602|PWY-7619|PWY-7724}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38923 38923]
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: smiles=CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=cyclobutadipyrimidine}}
 +
{{#set: inchi key=InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=238.246    }}
 +
{{#set: produced by=3.2.2.17-RXN}}

Latest revision as of 19:40, 21 March 2018

Metabolite CPD-15526

  • smiles:
    • CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))
  • common name:
    • cyclobutadipyrimidine
  • inchi key:
    • InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N
  • molecular weight:
    • 238.246
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-15526&oldid=43157"