Difference between revisions of "Tiso gene 16765"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Methyl-Adenines 3-Methyl-Adenines] == * smiles: ** CN1(C2(=NC=NC(=C(N)N=C1)2)) * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_16765 == * right end position: ** 3679 * transcription direction: ** NEGATIVE * left end position: ** 428 * centisome position: ** 10.35066...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16765 == |
− | * | + | * right end position: |
− | ** | + | ** 3679 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 428 |
− | * | + | * centisome position: |
− | ** | + | ** 10.350665 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[CHD-RXN]] | |
− | * [[RXN0- | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN0-7230]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[CHOLINE-BETAINE-ANA-PWY]] | ||
+ | * [[BETSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3679}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=428}} | |
− | + | {{#set: centisome position=10.350665 }} | |
− | + | {{#set: reaction associated=CHD-RXN|RXN0-7230}} | |
− | + | {{#set: pathway associated=CHOLINE-BETAINE-ANA-PWY|BETSYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:41, 21 March 2018
Gene Tiso_gene_16765
- right end position:
- 3679
- transcription direction:
- NEGATIVE
- left end position:
- 428
- centisome position:
- 10.350665
- Synonym(s):
Reactions associated
- Reaction: CHD-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN0-7230
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation