Difference between revisions of "3-CARBOXY-3-HYDROXY-ISOCAPROATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14246 == * left end position: ** 191 * transcription direction: ** NEGATIVE * right end position: ** 2958 * centisome position: ** 3.320007...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] == * smiles: ** CC(C)C(O)(CC(=...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(O)(CC(=O)[O-])C([O-])=O |
− | * | + | * common name: |
− | ** | + | ** (2S)-2-isopropylmalate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=BITYXLXUCSKTJS-ZETCQYMHSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 174.153 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-hydroxy-4-methyl-3-carboxypentanoate | ||
+ | ** 3-carboxy-3-hydroxy-4-methylpentanoate | ||
+ | ** 3-carboxy-3-hydroxy-isocaproate | ||
+ | ** α-isopropylmalate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[IPMS]] | |
− | + | * [[2-ISOPROPYLMALATESYN-RXN]] | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | * [[3-ISOPROPYLMALISOM-RXN]] | |
− | + | * [[RXN-13163]] | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419726 6419726] |
− | {{#set: | + | * HMDB : HMDB00402 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02504 C02504] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.4925359.html 4925359] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1178 1178] | ||
+ | * BIGG : 3c3hmp | ||
+ | {{#set: smiles=CC(C)C(O)(CC(=O)[O-])C([O-])=O}} | ||
+ | {{#set: common name=(2S)-2-isopropylmalate}} | ||
+ | {{#set: inchi key=InChIKey=BITYXLXUCSKTJS-ZETCQYMHSA-L}} | ||
+ | {{#set: molecular weight=174.153 }} | ||
+ | {{#set: common name=3-hydroxy-4-methyl-3-carboxypentanoate|3-carboxy-3-hydroxy-4-methylpentanoate|3-carboxy-3-hydroxy-isocaproate|α-isopropylmalate}} | ||
+ | {{#set: produced by=IPMS|2-ISOPROPYLMALATESYN-RXN}} | ||
+ | {{#set: reversible reaction associated=3-ISOPROPYLMALISOM-RXN|RXN-13163}} |
Latest revision as of 19:41, 21 March 2018
Contents
Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE
- smiles:
- CC(C)C(O)(CC(=O)[O-])C([O-])=O
- common name:
- (2S)-2-isopropylmalate
- inchi key:
- InChIKey=BITYXLXUCSKTJS-ZETCQYMHSA-L
- molecular weight:
- 174.153
- Synonym(s):
- 3-hydroxy-4-methyl-3-carboxypentanoate
- 3-carboxy-3-hydroxy-4-methylpentanoate
- 3-carboxy-3-hydroxy-isocaproate
- α-isopropylmalate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(O)(CC(=O)[O-])C([O-])=O" cannot be used as a page name in this wiki.