Difference between revisions of "RXN3O-218"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE] == * smiles: ** C2([N+]=CN...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-218 RXN3O-218] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-218 RXN3O-218] ==
−
* smiles:
+
* direction:
−
** C2([N+]=CN(C1(OC(COP([O-])(=O)[O-])C(O)C(O)1))C(N)=2)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=PDACUKOKVHBVHJ-XVFCMESISA-M
+
** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20]
−
* common name:
+
−
** 5-amino-1-(5-phospho-β-D-ribosyl)imidazole
+
−
* molecular weight:
+
−
** 294.18   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-aminoimidazole ribonucleotide
 
−
** 5-amino-1-(5-phospho-D-ribosyl)imidazole
 
−
** 5-aminoimidazole ribotide
 
−
** AIR
 
−
** 1-(5'-phosphoribosyl)-5-aminoimidazole
 
−
** 5'-phosphoribosyl-5-aminoimidazole
 
−
** phosphoribosylaminoimidazole
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-742]]
+
* With identifiers:
−
* [[AIRCARBOXY-RXN]]
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[EPISTEROL]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''=>''' 1 [[CPD-700]][c] '''+''' 2 [[WATER]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[AIRS-RXN]]
+
** 1 oxygen[c] '''+''' 2 H+[c] '''+''' 1 episterol[c] '''+''' 2 a ferrocytochrome b5[c] '''=>''' 1 ergosta-5,7,24(28)-trien-3β-ol[c] '''+''' 2 H2O[c] '''+''' 2 a ferricytochrome b5[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5446]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-6075]], ergosterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6075 PWY-6075]
 +
** '''1''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541]
 +
** '''10''' reactions found over '''36''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 25635-88-5
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33463 33463]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229244 44229244]
+
* LIGAND-RXN:
−
* HMDB : HMDB01235
+
** [http://www.genome.jp/dbget-bin/www_bget?R07505 R07505]
−
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?R07491 R07491]
−
** [http://www.genome.jp/dbget-bin/www_bget?C03373 C03373]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* CHEBI:
+
{{#set: ec number=EC-1.14.19.20}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28843 28843]
+
{{#set: gene associated=Tiso_gene_5446}}
−
* BIGG : air
+
{{#set: in pathway=PWY-6075|PWY-2541}}
−
{{#set: smiles=C2([N+]=CN(C1(OC(COP([O-])(=O)[O-])C(O)C(O)1))C(N)=2)}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=PDACUKOKVHBVHJ-XVFCMESISA-M}}
+
{{#set: reconstruction source=orthology-athaliana}}
−
{{#set: common name=5-amino-1-(5-phospho-β-D-ribosyl)imidazole}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=294.18    }}
+
−
{{#set: common name=5-aminoimidazole ribonucleotide|5-amino-1-(5-phospho-D-ribosyl)imidazole|5-aminoimidazole ribotide|AIR|1-(5'-phosphoribosyl)-5-aminoimidazole|5'-phosphoribosyl-5-aminoimidazole|phosphoribosylaminoimidazole}}
+
−
{{#set: consumed by=RXN0-742|AIRCARBOXY-RXN}}
+
−
{{#set: produced by=AIRS-RXN}}
+

Latest revision as of 19:41, 21 March 2018

Reaction RXN3O-218

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6075, ergosterol biosynthesis I: PWY-6075
    • 1 reactions found over 5 reactions in the full pathway
  • PWY-2541, plant sterol biosynthesis: PWY-2541
    • 10 reactions found over 36 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN3O-218&oldid=43210"