Difference between revisions of "PWY-7606"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] == * smiles: ** C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2)) * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** docosahexaenoate biosynthesis III (6-desaturase, mammals) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''14''' reactions found over '''14''' reactions in the full pathway | |
− | * [[RXN- | + | * [[RXN-13442]] |
− | + | ** 0 associated gene: | |
− | * [[ | + | ** 2 reconstruction source(s) associated: |
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-13443]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_9871]] | ||
+ | *** [[Tiso_gene_13083]] | ||
+ | *** [[Tiso_gene_9885]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-13444]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-13445]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-16082]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-16103]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-16129]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_9871]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-16130]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-16131]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-16132]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-16134]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_18566]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-16135]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-16136]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-16137]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Tiso_gene_17451]] | ||
+ | *** [[Tiso_gene_15327]] | ||
+ | *** [[Tiso_gene_3856]] | ||
+ | *** [[Tiso_gene_10116]] | ||
+ | *** [[Tiso_gene_3855]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=docosahexaenoate biosynthesis III (6-desaturase, mammals)}} | |
− | + | {{#set: reaction found=14}} | |
− | + | {{#set: total reaction=14}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:41, 21 March 2018
Pathway PWY-7606
- taxonomic range:
- common name:
- docosahexaenoate biosynthesis III (6-desaturase, mammals)
- Synonym(s):
Reaction(s) found
14 reactions found over 14 reactions in the full pathway
- RXN-13442
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-13443
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-13444
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-13445
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-16082
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-16103
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-16129
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-16130
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-16131
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-16132
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-16134
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-16135
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-16136
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-16137
- 5 associated gene(s):
- 2 reconstruction source(s) associated: