Difference between revisions of "CPD-2744"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_3991 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-esiliculosus == Pathways associated == ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == * smiles: ** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == |
+ | * smiles: | ||
+ | ** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3)) | ||
+ | * common name: | ||
+ | ** nicotine-glucuronide | ||
+ | * inchi key: | ||
+ | ** InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O | ||
+ | * molecular weight: | ||
+ | ** 339.367 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-83]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820524 91820524] | ||
+ | * HMDB : HMDB01272 | ||
+ | {{#set: smiles=C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}} | ||
+ | {{#set: common name=nicotine-glucuronide}} | ||
+ | {{#set: inchi key=InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O}} | ||
+ | {{#set: molecular weight=339.367 }} | ||
+ | {{#set: produced by=RXN66-83}} |
Latest revision as of 19:42, 21 March 2018
Contents
Metabolite CPD-2744
- smiles:
- C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
- common name:
- nicotine-glucuronide
- inchi key:
- InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
- molecular weight:
- 339.367
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB01272
"C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))" cannot be used as a page name in this wiki.