Difference between revisions of "GLYOXDEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYOXDEG-PWY GLYOXDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 T...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYOXDEG-PWY GLYOXDEG-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** glycolate and glyoxylate degradation II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** glyoxylate degradation |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''2''' reactions in the full pathway |
− | + | * [[MALSYN-RXN]] | |
− | * [[ | + | ** 1 associated gene(s): |
− | == Reaction(s) | + | *** [[Tiso_gene_14377]] |
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLATEDEHYDRO-RXN GLYCOLATEDEHYDRO-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLYOXDEG-PWY GLYOXDEG-PWY] |
− | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
− | {{#set: | + | {{#set: common name=glycolate and glyoxylate degradation II}} |
− | {{#set: common name= | + | {{#set: common name=glyoxylate degradation}} |
− | {{#set: | + | {{#set: reaction found=1}} |
− | {{#set: | + | {{#set: total reaction=2}} |
− | {{#set: | + | {{#set: completion rate=50.0}} |
− | + |
Latest revision as of 19:43, 21 March 2018
Pathway GLYOXDEG-PWY
- taxonomic range:
- common name:
- glycolate and glyoxylate degradation II
- Synonym(s):
- glyoxylate degradation
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- MALSYN-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: