Difference between revisions of "N-ACETYL-BETA-GLUCOSAMINYLAMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-FORMYL-THF 5-FORMYL-THF] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-BETA-GLUCOSAMINYLAMINE N-ACETYL-BETA-GLUCOSAMINYLAMINE] == * smiles: ** CC(=O)NC1(C(N)...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-BETA-GLUCOSAMINYLAMINE N-ACETYL-BETA-GLUCOSAMINYLAMINE] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=O)NC1(C(N)OC(CO)C(O)C(O)1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** N-acetyl-β-glucosaminylamine |
+ | * inchi key: | ||
+ | ** InChIKey=MCGXOCXFFNKASF-FMDGEEDCSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 220.225 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[3.5.1.52-RXN]] |
− | + | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439454 439454] |
− | + | ||
− | + | ||
− | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.388560.html 388560] |
+ | * HMDB : HMDB01104 | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15947 15947] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01239 C01239] |
− | {{#set: | + | {{#set: smiles=CC(=O)NC1(C(N)OC(CO)C(O)C(O)1)}} |
− | {{#set: | + | {{#set: common name=N-acetyl-β-glucosaminylamine}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=MCGXOCXFFNKASF-FMDGEEDCSA-N}} |
− | + | {{#set: molecular weight=220.225 }} | |
− | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=3.5.1.52-RXN}} |
Latest revision as of 19:43, 21 March 2018
Contents
Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE
- smiles:
- CC(=O)NC1(C(N)OC(CO)C(O)C(O)1)
- common name:
- N-acetyl-β-glucosaminylamine
- inchi key:
- InChIKey=MCGXOCXFFNKASF-FMDGEEDCSA-N
- molecular weight:
- 220.225
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links