Difference between revisions of "Tiso gene 9325"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * inchi key: ** InChIKey=WQZGKK...") |
(Created page with "Category:Gene == Gene Tiso_gene_9325 == * right end position: ** 4912 * transcription direction: ** POSITIVE * left end position: ** 2353 * centisome position: ** 24.97611...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9325 == |
− | * | + | * right end position: |
− | ** | + | ** 4912 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2353 |
− | * | + | * centisome position: |
− | ** | + | ** 24.976118 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[R468-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5169]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4912}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=2353}} | |
− | + | {{#set: centisome position=24.976118 }} | |
− | + | {{#set: reaction associated=R468-RXN}} | |
− | + | {{#set: pathway associated=PWY-5169}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:43, 21 March 2018
Gene Tiso_gene_9325
- right end position:
- 4912
- transcription direction:
- POSITIVE
- left end position:
- 2353
- centisome position:
- 24.976118
- Synonym(s):
Reactions associated
- Reaction: R468-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation