Difference between revisions of "5-FORMYL-THF"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=SALVPURINE2-PWY SALVPURINE2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-FORMYL-THF 5-FORMYL-THF] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-FORMYL-THF 5-FORMYL-THF] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N([CH]=O)3)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (6S)-5-formyl-tetrahydrofolate mono-L-glutamate |
+ | * inchi key: | ||
+ | ** InChIKey=VVIAGPKUTFNRDU-STQMWFEESA-L | ||
+ | * molecular weight: | ||
+ | ** 471.429 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** n5-formyltetrahydrofolate monoglutamate | ||
+ | ** n5-formyl-thf monoglutamate | ||
+ | ** N5-formyl-THF monoglutamate | ||
+ | ** 5-formyl-H4F monoglutamate | ||
+ | ** 5-formyl-THF monoglutamate | ||
+ | ** folinic acid monoglutamate | ||
+ | ** 5-CHO-THF monoglutamate | ||
+ | ** folinate | ||
+ | ** formyl-H4F monoglutamate | ||
+ | ** citrovorum factor | ||
+ | ** N5-formyl-H4F monoglutamate | ||
+ | ** N5-formyl-H4PteGlu1 | ||
+ | ** (6S)-leucovorin | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[5FTHFt]] | |
− | + | * [[5FTHFtm]] | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 58-05-9 |
− | ** [http:// | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6560146 6560146] | |
− | {{#set: | + | * HMDB : HMDB01562 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03479 C03479] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5028014.html 5028014] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57457 57457] | ||
+ | * METABOLIGHTS : MTBLC57457 | ||
+ | {{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N([CH]=O)3))}} | ||
+ | {{#set: common name=(6S)-5-formyl-tetrahydrofolate mono-L-glutamate}} | ||
+ | {{#set: inchi key=InChIKey=VVIAGPKUTFNRDU-STQMWFEESA-L}} | ||
+ | {{#set: molecular weight=471.429 }} | ||
+ | {{#set: common name=n5-formyltetrahydrofolate monoglutamate|n5-formyl-thf monoglutamate|N5-formyl-THF monoglutamate|5-formyl-H4F monoglutamate|5-formyl-THF monoglutamate|folinic acid monoglutamate|5-CHO-THF monoglutamate|folinate|formyl-H4F monoglutamate|citrovorum factor|N5-formyl-H4F monoglutamate|N5-formyl-H4PteGlu1|(6S)-leucovorin}} | ||
+ | {{#set: reversible reaction associated=5FTHFt|5FTHFtm}} |
Latest revision as of 19:43, 21 March 2018
Contents
Metabolite 5-FORMYL-THF
- smiles:
- C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N([CH]=O)3))
- common name:
- (6S)-5-formyl-tetrahydrofolate mono-L-glutamate
- inchi key:
- InChIKey=VVIAGPKUTFNRDU-STQMWFEESA-L
- molecular weight:
- 471.429
- Synonym(s):
- n5-formyltetrahydrofolate monoglutamate
- n5-formyl-thf monoglutamate
- N5-formyl-THF monoglutamate
- 5-formyl-H4F monoglutamate
- 5-formyl-THF monoglutamate
- folinic acid monoglutamate
- 5-CHO-THF monoglutamate
- folinate
- formyl-H4F monoglutamate
- citrovorum factor
- N5-formyl-H4F monoglutamate
- N5-formyl-H4PteGlu1
- (6S)-leucovorin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 58-05-9
- PUBCHEM:
- HMDB : HMDB01562
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57457
"C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N([CH]=O)3))" cannot be used as a page name in this wiki.