Difference between revisions of "PWY-6064"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] == * smiles: ** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O * inchi key: ** InChI...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6064 PWY-6064] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58023 TAX-5...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6064 PWY-6064] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58023 TAX-58023] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3195 TAX-3195] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3208 TAX-3208] |
* common name: | * common name: | ||
| − | ** | + | ** methylquercetin biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[ | + | * [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_14431]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8262 RXN-8262] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-58023}} | |
| − | + | {{#set: taxonomic range=TAX-3195}} | |
| − | {{#set: | + | {{#set: taxonomic range=TAX-3208}} |
| − | {{#set: | + | {{#set: common name=methylquercetin biosynthesis}} |
| − | {{#set: common name= | + | {{#set: reaction found=1}} |
| − | {{#set: | + | {{#set: total reaction=2}} |
| − | {{#set: | + | {{#set: completion rate=50.0}} |
| − | {{#set: | + | |
Latest revision as of 19:44, 21 March 2018
Pathway PWY-6064
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- QUERCETIN-3-O-METHYLTRANSFERASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
