Difference between revisions of "Tiso gene 7213"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-AMINO-LEVULINATE 5-AMINO-LEVULINATE] == * smiles: ** C(C(C[N+])=O)CC([O-])=O * inchi key: **...")
 
(Created page with "Category:Gene == Gene Tiso_gene_7213 == * right end position: ** 20001 * transcription direction: ** NEGATIVE * left end position: ** 10392 * centisome position: ** 37.087...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-AMINO-LEVULINATE 5-AMINO-LEVULINATE] ==
+
== Gene Tiso_gene_7213 ==
−
* smiles:
+
* right end position:
−
** C(C(C[N+])=O)CC([O-])=O
+
** 20001
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZGXJTSGNIOSYLO-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 5-aminolevulinate
+
** 10392
−
* molecular weight:
+
* centisome position:
−
** 131.131    
+
** 37.087795    
 
* Synonym(s):
 
* Synonym(s):
−
** 5-amino-4-oxopentanoate
 
−
** 5-amino-4-oxo-pentanoic acid
 
−
** 5-amino-levulinic acid
 
−
** 5-amino-4-oxopentanoic acid
 
−
** δ-aminolevulinate
 
−
** 5-aminolevulinic acid
 
−
** 5-amino-levulinate
 
−
** ALA
 
−
** δ-aminolevulinic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[PORPHOBILSYNTH-RXN]]
+
* Reaction: [[ATPSYN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[GSAAMINOTRANS-RXN]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 
== External links  ==
 
== External links  ==
−
* CAS : 106-60-5
+
{{#set: right end position=20001}}
−
* METABOLIGHTS : MTBLC356416
+
{{#set: transcription direction=NEGATIVE}}
−
* PUBCHEM:
+
{{#set: left end position=10392}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7048523 7048523]
+
{{#set: centisome position=37.087795   }}
−
* HMDB : HMDB01149
+
{{#set: reaction associated=ATPSYN-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7219}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00430 C00430]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=356416 356416]
+
−
* BIGG : 5aop
+
−
{{#set: smiles=C(C(C[N+])=O)CC([O-])=O}}
+
−
{{#set: inchi key=InChIKey=ZGXJTSGNIOSYLO-UHFFFAOYSA-N}}
+
−
{{#set: common name=5-aminolevulinate}}
+
−
{{#set: molecular weight=131.131   }}
+
−
{{#set: common name=5-amino-4-oxopentanoate|5-amino-4-oxo-pentanoic acid|5-amino-levulinic acid|5-amino-4-oxopentanoic acid|δ-aminolevulinate|5-aminolevulinic acid|5-amino-levulinate|ALA|δ-aminolevulinic acid}}
+
−
{{#set: consumed by=PORPHOBILSYNTH-RXN}}
+
−
{{#set: produced by=GSAAMINOTRANS-RXN}}
+

Latest revision as of 19:27, 21 March 2018

Gene Tiso_gene_7213

  • right end position:
    • 20001
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 10392
  • centisome position:
    • 37.087795
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7213&oldid=41710"