Difference between revisions of "CPDQT-27"

Latest revision as of 19:44, 21 March 2018

"CSCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_10561 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] ==
+* smiles:
+** CSCCCCC(=O)C([O-])=O
+* common name:
+** 6-(methylthio)-2-oxohexanoate
+* inchi key:
+** InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M
+* molecular weight:
+** 175.222
 * Synonym(s):
+** 6-(methylthio)-2-oxohexanoic acid
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
+== Reaction(s) known to produce the compound ==
-** [[pantograph]]-[[athaliana]]
+* [[RXN-18209]]
-** [[pantograph]]-[[esiliculosus]]
+* [[RXNQT-4165]]
-== Pathways associated ==
+== Reaction(s) of unknown directionality ==
-* [[PWY-6792]]
-* [[PWY-1121]]
-* [[PWY-5710]]
-* [[PWY-7498]]
-* [[PWY-6039]]
-* [[PWY-7398]]
-* [[PWY-361]]
 == External links  ==
-{{#set: reaction associated=CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN}}
+* PUBCHEM:
-{{#set: pathway associated=PWY-6792|PWY-1121|PWY-5710|PWY-7498|PWY-6039|PWY-7398|PWY-361}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237195 44237195]
+* KNAPSACK : C00007648
+{{#set: smiles=CSCCCCC(=O)C([O-])=O}}
+{{#set: common name=6-(methylthio)-2-oxohexanoate}}
+{{#set: inchi key=InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M}}
+{{#set: molecular weight=175.222    }}
+{{#set: common name=6-(methylthio)-2-oxohexanoic acid}}
+{{#set: produced by=RXN-18209|RXNQT-4165}}