Difference between revisions of "CPD-3943"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2002 PWY-2002] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-38...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2002 PWY-2002] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803]
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** isoflavonoid biosynthesis I
+
** (22α)-hydroxy-campesterol
 +
* inchi key:
 +
** InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N
 +
* molecular weight:
 +
** 416.686   
 
* Synonym(s):
 
* Synonym(s):
 +
** (22S)-22-hydroxy-campesterol
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''5''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-3221]]
+
* [[RXN-4225]]
−
** 2 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_13414]]
+
−
*** [[Tiso_gene_9838]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3283 RXN-3283]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3284 RXN-3284]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3481 RXN-3481]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3501 RXN-3501]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-3803}}
+
* LIPID_MAPS : LMST01031115
−
{{#set: common name=isoflavonoid biosynthesis I}}
+
* PUBCHEM:
−
{{#set: reaction found=1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341628 15341628]
−
{{#set: total reaction=5}}
+
* CHEMSPIDER:
−
{{#set: completion rate=20.0}}
+
** [http://www.chemspider.com/Chemical-Structure.9308624.html 9308624]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72331 72331]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15795 C15795]
 +
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=(22α)-hydroxy-campesterol}}
 +
{{#set: inchi key=InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N}}
 +
{{#set: molecular weight=416.686    }}
 +
{{#set: common name=(22S)-22-hydroxy-campesterol}}
 +
{{#set: produced by=RXN-4225}}

Latest revision as of 19:45, 21 March 2018

Metabolite CPD-3943

  • smiles:
    • CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • (22α)-hydroxy-campesterol
  • inchi key:
    • InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N
  • molecular weight:
    • 416.686
  • Synonym(s):
    • (22S)-22-hydroxy-campesterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-3943&oldid=43597"