Difference between revisions of "RXN-2141"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14405 CPD-14405] == * smiles: ** CCCCCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2141 RXN-2141] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14405 CPD-14405] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2141 RXN-2141] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GFVFSXUAKLZOGC-NULWUIHISA-J
+
−
* common name:
+
−
** 3R-hydroxy-dihomo γ-linolenoyl-CoA
+
−
* molecular weight:
+
−
** 1067.974   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (8Z,11Z,14Z)-3R-hydroxy-icosa-8,11,14-trienoyl-CoA
 
−
** (8Z,11Z,14Z)-3R-hydroxy-icosatrienoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12968]]
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[ALPHA-MALTOSE]][c] '''=>''' 2.0 [[ALPHA-GLUCOSE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H2O[c] '''+''' 1.0 α-maltose[c] '''=>''' 2.0 α-D-glucopyranose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2588]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_4953]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_4952]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551500 72551500]
+
{{#set: gene associated=Tiso_gene_2588|Tiso_gene_4953|Tiso_gene_4952}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76411 76411]
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: inchi key=InChIKey=GFVFSXUAKLZOGC-NULWUIHISA-J}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=3R-hydroxy-dihomo γ-linolenoyl-CoA}}
+
−
{{#set: molecular weight=1067.974    }}
+
−
{{#set: common name=(8Z,11Z,14Z)-3R-hydroxy-icosa-8,11,14-trienoyl-CoA|(8Z,11Z,14Z)-3R-hydroxy-icosatrienoyl-CoA}}
+
−
{{#set: produced by=RXN-12968}}
+

Latest revision as of 19:46, 21 March 2018

Reaction RXN-2141

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 α-maltose[c] => 2.0 α-D-glucopyranose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-2141&oldid=43625"