Difference between revisions of "RXN-16130"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-15-BISPHOSPHATE RIBOSE-15-BISPHOSPHATE] == * smiles: ** C(C1(OC(C(C1O)O)OP([O-])([O-])=O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16130 RXN-16130] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-15-BISPHOSPHATE RIBOSE-15-BISPHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16130 RXN-16130] ==
−
* smiles:
+
* direction:
−
** C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=AAAFZMYJJHWUPN-TXICZTDVSA-J
+
** [http://enzyme.expasy.org/EC/4.2.1.134 EC-4.2.1.134]
−
* common name:
+
−
** α-D-ribose 1,5-bisphosphate
+
−
* molecular weight:
+
−
** 306.059   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ribose-1,5-bisphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-1401]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-17382]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-17383]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 (3R)-hydroxy-tetracosapentaenoyl-CoA[c] '''=>''' 1 H2O[c] '''+''' 1 (2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7606]], docosahexaenoate biosynthesis III (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606]
 +
** '''14''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01151 C01151]
+
{{#set: ec number=EC-4.2.1.134}}
−
* CHEBI:
+
{{#set: in pathway=PWY-7606}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68688 68688]
+
{{#set: reconstruction category=annotation}}
−
* BIGG : r15bp
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
* PUBCHEM:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678980 70678980]
+
−
* HMDB : HMDB11688
+
−
{{#set: smiles=C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O}}
+
−
{{#set: inchi key=InChIKey=AAAFZMYJJHWUPN-TXICZTDVSA-J}}
+
−
{{#set: common name=α-D-ribose 1,5-bisphosphate}}
+
−
{{#set: molecular weight=306.059    }}
+
−
{{#set: common name=ribose-1,5-bisphosphate}}
+
−
{{#set: consumed by=RXN0-1401}}
+

Latest revision as of 19:27, 21 March 2018

Reaction RXN-16130

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (3R)-hydroxy-tetracosapentaenoyl-CoA[c] => 1 H2O[c] + 1 (2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA[c]

Genes associated with this reaction

Pathways

  • PWY-7606, docosahexaenoate biosynthesis III (6-desaturase, mammals): PWY-7606
    • 14 reactions found over 14 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16130&oldid=41718"