Difference between revisions of "DIACETYL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIACETYL DIACETYL] == * smiles: ** CC(C(C)=O)=O * common name: ** diacetyl * inchi key: ** InCh...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIACETYL DIACETYL] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C(C)=O)=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** diacetyl |
+ | * inchi key: | ||
+ | ** InChIKey=QSJXEFYPDANLFS-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 86.09 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2,3-butanedione |
− | ** | + | ** biacetyl |
− | ** | + | ** dimethylglyoxal |
+ | ** 2,3-diketobutane | ||
+ | ** 2,3-dioxobutane | ||
+ | ** butadione | ||
+ | ** dimethyl diketone | ||
+ | ** butanedione | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-6081]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * CAS : | + | * CAS : 431-03-8 |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=650 650] |
− | * | + | * HMDB : HMDB03407 |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00741 C00741] |
− | {{#set: smiles= | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.630.html 630] |
− | {{#set: | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16583 16583] |
− | {{#set: common name= | + | {{#set: smiles=CC(C(C)=O)=O}} |
− | + | {{#set: common name=diacetyl}} | |
− | {{#set: produced by=RXN- | + | {{#set: inchi key=InChIKey=QSJXEFYPDANLFS-UHFFFAOYSA-N}} |
+ | {{#set: molecular weight=86.09 }} | ||
+ | {{#set: common name=2,3-butanedione|biacetyl|dimethylglyoxal|2,3-diketobutane|2,3-dioxobutane|butadione|dimethyl diketone|butanedione}} | ||
+ | {{#set: produced by=RXN-6081}} |
Latest revision as of 20:46, 21 March 2018
Contents
Metabolite DIACETYL
- smiles:
- CC(C(C)=O)=O
- common name:
- diacetyl
- inchi key:
- InChIKey=QSJXEFYPDANLFS-UHFFFAOYSA-N
- molecular weight:
- 86.09
- Synonym(s):
- 2,3-butanedione
- biacetyl
- dimethylglyoxal
- 2,3-diketobutane
- 2,3-dioxobutane
- butadione
- dimethyl diketone
- butanedione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links