Difference between revisions of "Tiso gene 8531"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] == * smiles: ** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2...")
(Created page with "Category:Gene == Gene Tiso_gene_8531 == * Synonym(s): == Reactions associated == * Reaction: RXN-8999 ** Source: orthology-athaliana ** Source: orthology-synech...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] ==
+
== Gene Tiso_gene_8531 ==
* smiles:
+
** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))
+
* inchi key:
+
** InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M
+
* common name:
+
** tetraiodothyroacetate ester glucuronide
+
* molecular weight:
+
** 922.95   
+
 
* Synonym(s):
 
* Synonym(s):
** tetraiodothyroacetic acid ester glucuronide
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-8999]]
* [[RXN-10617]]
+
** Source: [[orthology-athaliana]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN0-5180]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-5785]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-8999|RXN0-5180}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657880 90657880]
+
{{#set: pathway associated=PWY-5785}}
{{#set: smiles=C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))}}
+
{{#set: inchi key=InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M}}
+
{{#set: common name=tetraiodothyroacetate ester glucuronide}}
+
{{#set: molecular weight=922.95    }}
+
{{#set: common name=tetraiodothyroacetic acid ester glucuronide}}
+
{{#set: produced by=RXN-10617}}
+

Latest revision as of 19:47, 21 March 2018

Gene Tiso_gene_8531

  • Synonym(s):

Reactions associated

Pathways associated

External links