Difference between revisions of "CPD-7196"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-388 CPD-388] == * smiles: ** CCCCCCCCCCCCCC[CH]=O * common name: ** pentadecanal * inchi ke...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] == * smiles: ** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4) |
* common name: | * common name: | ||
− | ** | + | ** 9-cis-violaxanthin |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 600.88 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 9-c-violaxanthin | ||
+ | ** 9cViol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7974]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282218 5282218] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35305 35305] |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C13433 C13433] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}} |
− | {{#set: molecular weight= | + | {{#set: common name=9-cis-violaxanthin}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N}} |
− | {{#set: | + | {{#set: molecular weight=600.88 }} |
+ | {{#set: common name=9-c-violaxanthin|9cViol}} | ||
+ | {{#set: consumed by=RXN-7974}} |
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite CPD-7196
- smiles:
- CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
- common name:
- 9-cis-violaxanthin
- inchi key:
- InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N
- molecular weight:
- 600.88
- Synonym(s):
- 9-c-violaxanthin
- 9cViol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links